C26H27FN2O2 — CID 67930368
4-[4-[2-(3-fluoro-4-nitrophenyl)ethenyl]phenyl]-N,N-dipropylaniline (PubChem CID 67930368) has the molecular formula C26H27FN2O2 and a molecular weight of 418.51 g/mol. Its IUPAC name is 4-[4-[2-(3-fluoro-4-nitrophenyl)ethenyl]phenyl]-N,N-dipropylaniline.
| Compound Name | 4-[4-[2-(3-fluoro-4-nitrophenyl)ethenyl]phenyl]-N,N-dipropylaniline |
|---|---|
| PubChem CID | 67930368 |
| Molecular Formula | C26H27FN2O2 |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 4-[4-[2-(3-fluoro-4-nitrophenyl)ethenyl]phenyl]-N,N-dipropylaniline |
| SMILES | CCCN(CCC)c1ccc(-c2ccc(C=Cc3ccc([N+](=O)[O-])c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C26H27FN2O2/c1-3-17-28(18-4-2)24-14-12-23(13-15-24)22-10-7-20(8-11-22)5-6-21-9-16-26(29(30)31)25(27)19-21/h5-16,19H,3-4,17-18H2,1-2H3 |
| InChIKey | SJHPYRSGCFJOQN-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|