C12H19N3O2 — CID 154940241
2-nitro-4-N,4-N-dipropylbenzene-1,4-diamine (PubChem CID 154940241) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-nitro-4-N,4-N-dipropylbenzene-1,4-diamine.
| Compound Name | 2-nitro-4-N,4-N-dipropylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 154940241 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 2-nitro-4-N,4-N-dipropylbenzene-1,4-diamine |
| SMILES | CCCN(CCC)c1ccc(N)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H19N3O2/c1-3-7-14(8-4-2)10-5-6-11(13)12(9-10)15(16)17/h5-6,9H,3-4,7-8,13H2,1-2H3 |
| InChIKey | GQWWVGVJAQUIAH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|