C18H26N6O7 — CID 87924364
2-[4-amino-N-(2-hydroxyethyl)-3-nitroanilino]ethanol;2-(4-amino-3-nitroanilino)ethanol (PubChem CID 87924364) has the molecular formula C18H26N6O7 and a molecular weight of 438.44 g/mol. Its IUPAC name is 2-[4-amino-N-(2-hydroxyethyl)-3-nitroanilino]ethanol;2-(4-amino-3-nitroanilino)ethanol.
| Compound Name | 2-[4-amino-N-(2-hydroxyethyl)-3-nitroanilino]ethanol;2-(4-amino-3-nitroanilino)ethanol |
|---|---|
| PubChem CID | 87924364 |
| Molecular Formula | C18H26N6O7 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 2-[4-amino-N-(2-hydroxyethyl)-3-nitroanilino]ethanol;2-(4-amino-3-nitroanilino)ethanol |
| SMILES | Nc1ccc(N(CCO)CCO)cc1[N+](=O)[O-].Nc1ccc(NCCO)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H15N3O4.C8H11N3O3/c11-9-2-1-8(7-10(9)13(16)17)12(3-5-14)4-6-15;9-7-2-1-6(10-3-4-12)5-8(7)11(13)14/h1-2,7,14-15H,3-6,11H2;1-2,5,10,12H,3-4,9H2 |
| InChIKey | GVTZFZIPQPGVSB-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 214.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|