C24H30N6O7 — CID 87243556
2-(4-amino-3-nitroanilino)ethanol;2-[4-anilino-N-(2-hydroxyethyl)-3-nitroanilino]ethanol (PubChem CID 87243556) has the molecular formula C24H30N6O7 and a molecular weight of 514.54 g/mol. Its IUPAC name is 2-(4-amino-3-nitroanilino)ethanol;2-[4-anilino-N-(2-hydroxyethyl)-3-nitroanilino]ethanol.
| Compound Name | 2-(4-amino-3-nitroanilino)ethanol;2-[4-anilino-N-(2-hydroxyethyl)-3-nitroanilino]ethanol |
|---|---|
| PubChem CID | 87243556 |
| Molecular Formula | C24H30N6O7 |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | 2-(4-amino-3-nitroanilino)ethanol;2-[4-anilino-N-(2-hydroxyethyl)-3-nitroanilino]ethanol |
| SMILES | Nc1ccc(NCCO)cc1[N+](=O)[O-].O=[N+]([O-])c1cc(N(CCO)CCO)ccc1Nc1ccccc1 |
| InChI | InChI=1S/C16H19N3O4.C8H11N3O3/c20-10-8-18(9-11-21)14-6-7-15(16(12-14)19(22)23)17-13-4-2-1-3-5-13;9-7-2-1-6(10-3-4-12)5-8(7)11(13)14/h1-7,12,17,20-21H,8-11H2;1-2,5,10,12H,3-4,9H2 |
| InChIKey | RECPKHHETSCAEW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 200.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|