C12H11N3O2 — CID 20831862
2-nitro-4-N-phenylbenzene-1,4-diamine (PubChem CID 20831862) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 2-nitro-4-N-phenylbenzene-1,4-diamine.
| Compound Name | 2-nitro-4-N-phenylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 20831862 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-nitro-4-N-phenylbenzene-1,4-diamine |
| SMILES | Nc1ccc(Nc2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H11N3O2/c13-11-7-6-10(8-12(11)15(16)17)14-9-4-2-1-3-5-9/h1-8,14H,13H2 |
| InChIKey | IIYLFHLAYZOGCK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|