C18H18N4 — CID 57184309
4-N-(4-anilinophenyl)benzene-1,2,4-triamine (PubChem CID 57184309) has the molecular formula C18H18N4 and a molecular weight of 290.37 g/mol. Its IUPAC name is 4-N-(4-anilinophenyl)benzene-1,2,4-triamine.
| Compound Name | 4-N-(4-anilinophenyl)benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 57184309 |
| Molecular Formula | C18H18N4 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 4-N-(4-anilinophenyl)benzene-1,2,4-triamine |
| SMILES | Nc1ccc(Nc2ccc(Nc3ccccc3)cc2)cc1N |
| InChI | InChI=1S/C18H18N4/c19-17-11-10-16(12-18(17)20)22-15-8-6-14(7-9-15)21-13-4-2-1-3-5-13/h1-12,21-22H,19-20H2 |
| InChIKey | YEBIAWQPBUBOOG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|