C14H17N3O — CID 106750281
4-N-(4-ethoxyphenyl)benzene-1,2,4-triamine (PubChem CID 106750281) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is 4-N-(4-ethoxyphenyl)benzene-1,2,4-triamine.
| Compound Name | 4-N-(4-ethoxyphenyl)benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 106750281 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 4-N-(4-ethoxyphenyl)benzene-1,2,4-triamine |
| SMILES | CCOc1ccc(Nc2ccc(N)c(N)c2)cc1 |
| InChI | InChI=1S/C14H17N3O/c1-2-18-12-6-3-10(4-7-12)17-11-5-8-13(15)14(16)9-11/h3-9,17H,2,15-16H2,1H3 |
| InChIKey | UYYCEKYQCXMQHF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|