C22H24N2O2 — CID 139791472
1-N,4-N-bis(4-ethoxyphenyl)benzene-1,4-diamine (PubChem CID 139791472) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 1-N,4-N-bis(4-ethoxyphenyl)benzene-1,4-diamine.
| Compound Name | 1-N,4-N-bis(4-ethoxyphenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 139791472 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 1-N,4-N-bis(4-ethoxyphenyl)benzene-1,4-diamine |
| SMILES | CCOc1ccc(Nc2ccc(Nc3ccc(OCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C22H24N2O2/c1-3-25-21-13-9-19(10-14-21)23-17-5-7-18(8-6-17)24-20-11-15-22(16-12-20)26-4-2/h5-16,23-24H,3-4H2,1-2H3 |
| InChIKey | AOAWKSHFGOWQHR-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |