C10H10ClN3OS — CID 43426956
4-chloro-N-(4-ethoxyphenyl)-1,2,5-thiadiazol-3-amine (PubChem CID 43426956) has the molecular formula C10H10ClN3OS and a molecular weight of 255.73 g/mol. Its IUPAC name is 4-chloro-N-(4-ethoxyphenyl)-1,2,5-thiadiazol-3-amine.
| Compound Name | 4-chloro-N-(4-ethoxyphenyl)-1,2,5-thiadiazol-3-amine |
|---|---|
| PubChem CID | 43426956 |
| Molecular Formula | C10H10ClN3OS |
| Molecular Weight | 255.73 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | 4-chloro-N-(4-ethoxyphenyl)-1,2,5-thiadiazol-3-amine |
| SMILES | CCOc1ccc(Nc2nsnc2Cl)cc1 |
| InChI | InChI=1S/C10H10ClN3OS/c1-2-15-8-5-3-7(4-6-8)12-10-9(11)13-16-14-10/h3-6H,2H2,1H3,(H,12,14) |
| InChIKey | PJKQZZGAAIPCBV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.73 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |