C10H10ClN3O2S — CID 43426983
4-chloro-N-(3,4-dimethoxyphenyl)-1,2,5-thiadiazol-3-amine (PubChem CID 43426983) has the molecular formula C10H10ClN3O2S and a molecular weight of 271.73 g/mol. Its IUPAC name is 4-chloro-N-(3,4-dimethoxyphenyl)-1,2,5-thiadiazol-3-amine.
| Compound Name | 4-chloro-N-(3,4-dimethoxyphenyl)-1,2,5-thiadiazol-3-amine |
|---|---|
| PubChem CID | 43426983 |
| Molecular Formula | C10H10ClN3O2S |
| Molecular Weight | 271.73 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 4-chloro-N-(3,4-dimethoxyphenyl)-1,2,5-thiadiazol-3-amine |
| SMILES | COc1ccc(Nc2nsnc2Cl)cc1OC |
| InChI | InChI=1S/C10H10ClN3O2S/c1-15-7-4-3-6(5-8(7)16-2)12-10-9(11)13-17-14-10/h3-5H,1-2H3,(H,12,14) |
| InChIKey | RBLAQNKGTADIBH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.73 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |