C15H13ClN2O2S — CID 43306672
7-chloro-N-(3,4-dimethoxyphenyl)-1,3-benzothiazol-2-amine (PubChem CID 43306672) has the molecular formula C15H13ClN2O2S and a molecular weight of 320.80 g/mol. Its IUPAC name is 7-chloro-N-(3,4-dimethoxyphenyl)-1,3-benzothiazol-2-amine.
| Compound Name | 7-chloro-N-(3,4-dimethoxyphenyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 43306672 |
| Molecular Formula | C15H13ClN2O2S |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 7-chloro-N-(3,4-dimethoxyphenyl)-1,3-benzothiazol-2-amine |
| SMILES | COc1ccc(Nc2nc3cccc(Cl)c3s2)cc1OC |
| InChI | InChI=1S/C15H13ClN2O2S/c1-19-12-7-6-9(8-13(12)20-2)17-15-18-11-5-3-4-10(16)14(11)21-15/h3-8H,1-2H3,(H,17,18) |
| InChIKey | NCUSBBOLOVNBAQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |