C16H14N2O3S — CID 110193650
2-anilino-6,7-dimethoxy-3,1-benzothiazin-4-one (PubChem CID 110193650) has the molecular formula C16H14N2O3S and a molecular weight of 314.37 g/mol. Its IUPAC name is 2-anilino-6,7-dimethoxy-3,1-benzothiazin-4-one.
| Compound Name | 2-anilino-6,7-dimethoxy-3,1-benzothiazin-4-one |
|---|---|
| PubChem CID | 110193650 |
| Molecular Formula | C16H14N2O3S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 2-anilino-6,7-dimethoxy-3,1-benzothiazin-4-one |
| SMILES | COc1cc2nc(Nc3ccccc3)sc(=O)c2cc1OC |
| InChI | InChI=1S/C16H14N2O3S/c1-20-13-8-11-12(9-14(13)21-2)18-16(22-15(11)19)17-10-6-4-3-5-7-10/h3-9H,1-2H3,(H,17,18) |
| InChIKey | WXAKIVLVWZGVJA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |