C24H24N2O5 — CID 19749183
[3-[(2,3,6,7-tetramethoxyacridin-9-yl)amino]phenyl]methanol (PubChem CID 19749183) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is [3-[(2,3,6,7-tetramethoxyacridin-9-yl)amino]phenyl]methanol.
| Compound Name | [3-[(2,3,6,7-tetramethoxyacridin-9-yl)amino]phenyl]methanol |
|---|---|
| PubChem CID | 19749183 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | [3-[(2,3,6,7-tetramethoxyacridin-9-yl)amino]phenyl]methanol |
| SMILES | COc1cc2nc3cc(OC)c(OC)cc3c(Nc3cccc(CO)c3)c2cc1OC |
| InChI | InChI=1S/C24H24N2O5/c1-28-20-9-16-18(11-22(20)30-3)26-19-12-23(31-4)21(29-2)10-17(19)24(16)25-15-7-5-6-14(8-15)13-27/h5-12,27H,13H2,1-4H3,(H,25,26) |
| InChIKey | CXFZRZIZNLSXJU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|