C27H29N3O5 — CID 19749249
2-[4-[(2,3,7-trimethoxy-6-methylacridin-9-yl)amino]phenyl]ethyl N-methylcarbamate (PubChem CID 19749249) has the molecular formula C27H29N3O5 and a molecular weight of 475.55 g/mol. Its IUPAC name is 2-[4-[(2,3,7-trimethoxy-6-methylacridin-9-yl)amino]phenyl]ethyl N-methylcarbamate.
| Compound Name | 2-[4-[(2,3,7-trimethoxy-6-methylacridin-9-yl)amino]phenyl]ethyl N-methylcarbamate |
|---|---|
| PubChem CID | 19749249 |
| Molecular Formula | C27H29N3O5 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 2-[4-[(2,3,7-trimethoxy-6-methylacridin-9-yl)amino]phenyl]ethyl N-methylcarbamate |
| SMILES | CNC(=O)OCCc1ccc(Nc2c3cc(OC)c(C)cc3nc3cc(OC)c(OC)cc23)cc1 |
| InChI | InChI=1S/C27H29N3O5/c1-16-12-21-19(13-23(16)32-3)26(20-14-24(33-4)25(34-5)15-22(20)30-21)29-18-8-6-17(7-9-18)10-11-35-27(31)28-2/h6-9,12-15H,10-11H2,1-5H3,(H,28,31)(H,29,30) |
| InChIKey | KGMNKOXFLOHMGC-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|