C25H25N3O2 — CID 19749120
[3-[(2,3,7-trimethylacridin-9-yl)amino]phenyl]methyl N-methylcarbamate (PubChem CID 19749120) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is [3-[(2,3,7-trimethylacridin-9-yl)amino]phenyl]methyl N-methylcarbamate.
| Compound Name | [3-[(2,3,7-trimethylacridin-9-yl)amino]phenyl]methyl N-methylcarbamate |
|---|---|
| PubChem CID | 19749120 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | [3-[(2,3,7-trimethylacridin-9-yl)amino]phenyl]methyl N-methylcarbamate |
| SMILES | CNC(=O)OCc1cccc(Nc2c3cc(C)ccc3nc3cc(C)c(C)cc23)c1 |
| InChI | InChI=1S/C25H25N3O2/c1-15-8-9-22-20(10-15)24(21-11-16(2)17(3)12-23(21)28-22)27-19-7-5-6-18(13-19)14-30-25(29)26-4/h5-13H,14H2,1-4H3,(H,26,29)(H,27,28) |
| InChIKey | OOQJAUGIPGJFHK-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|