C27H29N3O6 — CID 19749390
2-[3-[(2,3,6,7-tetramethoxyacridin-9-yl)amino]phenyl]ethyl N-methylcarbamate (PubChem CID 19749390) has the molecular formula C27H29N3O6 and a molecular weight of 491.54 g/mol. Its IUPAC name is 2-[3-[(2,3,6,7-tetramethoxyacridin-9-yl)amino]phenyl]ethyl N-methylcarbamate.
| Compound Name | 2-[3-[(2,3,6,7-tetramethoxyacridin-9-yl)amino]phenyl]ethyl N-methylcarbamate |
|---|---|
| PubChem CID | 19749390 |
| Molecular Formula | C27H29N3O6 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 2-[3-[(2,3,6,7-tetramethoxyacridin-9-yl)amino]phenyl]ethyl N-methylcarbamate |
| SMILES | CNC(=O)OCCc1cccc(Nc2c3cc(OC)c(OC)cc3nc3cc(OC)c(OC)cc23)c1 |
| InChI | InChI=1S/C27H29N3O6/c1-28-27(31)36-10-9-16-7-6-8-17(11-16)29-26-18-12-22(32-2)24(34-4)14-20(18)30-21-15-25(35-5)23(33-3)13-19(21)26/h6-8,11-15H,9-10H2,1-5H3,(H,28,31)(H,29,30) |
| InChIKey | UADDCNYYTIGANX-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 100.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|