C24H23N3O3 — CID 19749250
[3-[(2-methoxy-6-methylacridin-9-yl)amino]phenyl]methyl N-methylcarbamate (PubChem CID 19749250) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is [3-[(2-methoxy-6-methylacridin-9-yl)amino]phenyl]methyl N-methylcarbamate.
| Compound Name | [3-[(2-methoxy-6-methylacridin-9-yl)amino]phenyl]methyl N-methylcarbamate |
|---|---|
| PubChem CID | 19749250 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | [3-[(2-methoxy-6-methylacridin-9-yl)amino]phenyl]methyl N-methylcarbamate |
| SMILES | CNC(=O)OCc1cccc(Nc2c3ccc(C)cc3nc3ccc(OC)cc23)c1 |
| InChI | InChI=1S/C24H23N3O3/c1-15-7-9-19-22(11-15)27-21-10-8-18(29-3)13-20(21)23(19)26-17-6-4-5-16(12-17)14-30-24(28)25-2/h4-13H,14H2,1-3H3,(H,25,28)(H,26,27) |
| InChIKey | FORZELUMFSKCGQ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|