C18H22N2O — CID 142806892
ethane;2-methoxy-N,6-dimethylacridin-9-amine (PubChem CID 142806892) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is ethane;2-methoxy-N,6-dimethylacridin-9-amine.
| Compound Name | ethane;2-methoxy-N,6-dimethylacridin-9-amine |
|---|---|
| PubChem CID | 142806892 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | ethane;2-methoxy-N,6-dimethylacridin-9-amine |
| SMILES | CC.CNc1c2ccc(C)cc2nc2ccc(OC)cc12 |
| InChI | InChI=1S/C16H16N2O.C2H6/c1-10-4-6-12-15(8-10)18-14-7-5-11(19-3)9-13(14)16(12)17-2;1-2/h4-9H,1-3H3,(H,17,18);1-2H3 |
| InChIKey | TXYQWZDYUKARAP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|