C12H14N2O — CID 84619850
7-methoxy-N,4-dimethylquinolin-2-amine (PubChem CID 84619850) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 7-methoxy-N,4-dimethylquinolin-2-amine.
| Compound Name | 7-methoxy-N,4-dimethylquinolin-2-amine |
|---|---|
| PubChem CID | 84619850 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 7-methoxy-N,4-dimethylquinolin-2-amine |
| SMILES | CNc1cc(C)c2ccc(OC)cc2n1 |
| InChI | InChI=1S/C12H14N2O/c1-8-6-12(13-2)14-11-7-9(15-3)4-5-10(8)11/h4-7H,1-3H3,(H,13,14) |
| InChIKey | OHTXWBCTQHIDLR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |