C18H18N2O2 — CID 806171
N-(2,5-dimethoxyphenyl)-4-methylquinolin-2-amine (PubChem CID 806171) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-4-methylquinolin-2-amine.
| Compound Name | N-(2,5-dimethoxyphenyl)-4-methylquinolin-2-amine |
|---|---|
| PubChem CID | 806171 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-4-methylquinolin-2-amine |
| SMILES | COc1ccc(OC)c(Nc2cc(C)c3ccccc3n2)c1 |
| InChI | InChI=1S/C18H18N2O2/c1-12-10-18(19-15-7-5-4-6-14(12)15)20-16-11-13(21-2)8-9-17(16)22-3/h4-11H,1-3H3,(H,19,20) |
| InChIKey | XIVSIOSTZUPIFI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |