C18H15N2O4- — CID 5070932
2-(2,4-dimethoxyanilino)quinoline-4-carboxylate (PubChem CID 5070932) has the molecular formula C18H15N2O4- and a molecular weight of 323.33 g/mol. Its IUPAC name is 2-(2,4-dimethoxyanilino)quinoline-4-carboxylate.
| Compound Name | 2-(2,4-dimethoxyanilino)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 5070932 |
| Molecular Formula | C18H15N2O4- |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 2-(2,4-dimethoxyanilino)quinoline-4-carboxylate |
| SMILES | COc1ccc(Nc2cc(C(=O)[O-])c3ccccc3n2)c(OC)c1 |
| InChI | InChI=1S/C18H16N2O4/c1-23-11-7-8-15(16(9-11)24-2)20-17-10-13(18(21)22)12-5-3-4-6-14(12)19-17/h3-10H,1-2H3,(H,19,20)(H,21,22)/p-1 |
| InChIKey | DNMPGAIZNHLTTM-UHFFFAOYSA-M |
| XLogP | 2.36 |
| TPSA | 83.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |