C28H36N4O3 — CID 15990816
N-[3-[cyclohexyl(methyl)amino]propyl]-2-(2,4-dimethoxyanilino)quinoline-4-carboxamide (PubChem CID 15990816) has the molecular formula C28H36N4O3 and a molecular weight of 476.62 g/mol. Its IUPAC name is N-[3-[cyclohexyl(methyl)amino]propyl]-2-(2,4-dimethoxyanilino)quinoline-4-carboxamide.
| Compound Name | N-[3-[cyclohexyl(methyl)amino]propyl]-2-(2,4-dimethoxyanilino)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 15990816 |
| Molecular Formula | C28H36N4O3 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | N-[3-[cyclohexyl(methyl)amino]propyl]-2-(2,4-dimethoxyanilino)quinoline-4-carboxamide |
| SMILES | COc1ccc(Nc2cc(C(=O)NCCCN(C)C3CCCCC3)c3ccccc3n2)c(OC)c1 |
| InChI | InChI=1S/C28H36N4O3/c1-32(20-10-5-4-6-11-20)17-9-16-29-28(33)23-19-27(30-24-13-8-7-12-22(23)24)31-25-15-14-21(34-2)18-26(25)35-3/h7-8,12-15,18-20H,4-6,9-11,16-17H2,1-3H3,(H,29,33)(H,30,31) |
| InChIKey | SASASNHHBSXROE-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|