C27H34N4O2 — CID 15990959
N-[3-[cyclohexyl(methyl)amino]propyl]-2-(2-methoxyanilino)quinoline-4-carboxamide (PubChem CID 15990959) has the molecular formula C27H34N4O2 and a molecular weight of 446.60 g/mol. Its IUPAC name is N-[3-[cyclohexyl(methyl)amino]propyl]-2-(2-methoxyanilino)quinoline-4-carboxamide.
| Compound Name | N-[3-[cyclohexyl(methyl)amino]propyl]-2-(2-methoxyanilino)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 15990959 |
| Molecular Formula | C27H34N4O2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | N-[3-[cyclohexyl(methyl)amino]propyl]-2-(2-methoxyanilino)quinoline-4-carboxamide |
| SMILES | COc1ccccc1Nc1cc(C(=O)NCCCN(C)C2CCCCC2)c2ccccc2n1 |
| InChI | InChI=1S/C27H34N4O2/c1-31(20-11-4-3-5-12-20)18-10-17-28-27(32)22-19-26(29-23-14-7-6-13-21(22)23)30-24-15-8-9-16-25(24)33-2/h6-9,13-16,19-20H,3-5,10-12,17-18H2,1-2H3,(H,28,32)(H,29,30) |
| InChIKey | FLQCDXPXBHCUJM-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|