C30H34N4O — CID 20854476
2-(2-ethylanilino)-N-[3-(N-ethyl-3-methylanilino)propyl]quinoline-4-carboxamide (PubChem CID 20854476) has the molecular formula C30H34N4O and a molecular weight of 466.63 g/mol. Its IUPAC name is 2-(2-ethylanilino)-N-[3-(N-ethyl-3-methylanilino)propyl]quinoline-4-carboxamide.
| Compound Name | 2-(2-ethylanilino)-N-[3-(N-ethyl-3-methylanilino)propyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 20854476 |
| Molecular Formula | C30H34N4O |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | 2-(2-ethylanilino)-N-[3-(N-ethyl-3-methylanilino)propyl]quinoline-4-carboxamide |
| SMILES | CCc1ccccc1Nc1cc(C(=O)NCCCN(CC)c2cccc(C)c2)c2ccccc2n1 |
| InChI | InChI=1S/C30H34N4O/c1-4-23-13-6-8-16-27(23)32-29-21-26(25-15-7-9-17-28(25)33-29)30(35)31-18-11-19-34(5-2)24-14-10-12-22(3)20-24/h6-10,12-17,20-21H,4-5,11,18-19H2,1-3H3,(H,31,35)(H,32,33) |
| InChIKey | QNHGNFKVURABGS-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|