C32H38N4O — CID 20854620
N-[3-(N-butylanilino)propyl]-2-(4-propan-2-ylanilino)quinoline-4-carboxamide (PubChem CID 20854620) has the molecular formula C32H38N4O and a molecular weight of 494.68 g/mol. Its IUPAC name is N-[3-(N-butylanilino)propyl]-2-(4-propan-2-ylanilino)quinoline-4-carboxamide.
| Compound Name | N-[3-(N-butylanilino)propyl]-2-(4-propan-2-ylanilino)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 20854620 |
| Molecular Formula | C32H38N4O |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.30 |
| IUPAC Name | N-[3-(N-butylanilino)propyl]-2-(4-propan-2-ylanilino)quinoline-4-carboxamide |
| SMILES | CCCCN(CCCNC(=O)c1cc(Nc2ccc(C(C)C)cc2)nc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C32H38N4O/c1-4-5-21-36(27-12-7-6-8-13-27)22-11-20-33-32(37)29-23-31(35-30-15-10-9-14-28(29)30)34-26-18-16-25(17-19-26)24(2)3/h6-10,12-19,23-24H,4-5,11,20-22H2,1-3H3,(H,33,37)(H,34,35) |
| InChIKey | PRJMVYAUGGMRKB-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|