C23H26N4O — CID 24776773
2-[(2E)-2-benzylidenehydrazinyl]-N-hexylquinoline-4-carboxamide (PubChem CID 24776773) has the molecular formula C23H26N4O and a molecular weight of 374.49 g/mol. Its IUPAC name is 2-[(2E)-2-benzylidenehydrazinyl]-N-hexylquinoline-4-carboxamide.
| Compound Name | 2-[(2E)-2-benzylidenehydrazinyl]-N-hexylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 24776773 |
| Molecular Formula | C23H26N4O |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 2-[(2E)-2-benzylidenehydrazinyl]-N-hexylquinoline-4-carboxamide |
| SMILES | CCCCCCNC(=O)c1cc(N/N=C/c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C23H26N4O/c1-2-3-4-10-15-24-23(28)20-16-22(26-21-14-9-8-13-19(20)21)27-25-17-18-11-6-5-7-12-18/h5-9,11-14,16-17H,2-4,10,15H2,1H3,(H,24,28)(H,26,27)/b25-17+ |
| InChIKey | WWOIKNYIRCTVBS-KOEQRZSOSA-N |
| XLogP | 4.99 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|