C27H39N5O2 — CID 118332905
N-heptyl-6-[2-[[4-(hexylcarbamoyl)phenyl]methylidene]hydrazinyl]pyridine-3-carboxamide (PubChem CID 118332905) has the molecular formula C27H39N5O2 and a molecular weight of 465.64 g/mol. Its IUPAC name is N-heptyl-6-[2-[[4-(hexylcarbamoyl)phenyl]methylidene]hydrazinyl]pyridine-3-carboxamide.
| Compound Name | N-heptyl-6-[2-[[4-(hexylcarbamoyl)phenyl]methylidene]hydrazinyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118332905 |
| Molecular Formula | C27H39N5O2 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.31 |
| IUPAC Name | N-heptyl-6-[2-[[4-(hexylcarbamoyl)phenyl]methylidene]hydrazinyl]pyridine-3-carboxamide |
| SMILES | CCCCCCCNC(=O)c1ccc(NN=Cc2ccc(C(=O)NCCCCCC)cc2)nc1 |
| InChI | InChI=1S/C27H39N5O2/c1-3-5-7-9-11-19-29-27(34)24-16-17-25(30-21-24)32-31-20-22-12-14-23(15-13-22)26(33)28-18-10-8-6-4-2/h12-17,20-21H,3-11,18-19H2,1-2H3,(H,28,33)(H,29,34)(H,30,32) |
| InChIKey | CPOSGXPYEGDRBD-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|