C25H31N6O6 — CID 58299485
CID 58299485 (PubChem CID 58299485) has the molecular formula C25H31N6O6 and a molecular weight of 511.56 g/mol.
| Compound Name | CID 58299485 |
|---|---|
| PubChem CID | 58299485 |
| Molecular Formula | C25H31N6O6 |
| Molecular Weight | 511.56 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | — |
| SMILES | Cc1ccc(/C=N/Nc2ccc(C(=O)NCCCC[CH]NC(=O)NC(CCC(=O)O)C(=O)O)cn2)cc1 |
| InChI | InChI=1S/C25H31N6O6/c1-17-5-7-18(8-6-17)15-29-31-21-11-9-19(16-28-21)23(34)26-13-3-2-4-14-27-25(37)30-20(24(35)36)10-12-22(32)33/h5-9,11,14-16,20H,2-4,10,12-13H2,1H3,(H,26,34)(H,28,31)(H,32,33)(H,35,36)(H2,27,30,37)/b29-15+ |
| InChIKey | URDBZQAAPHMQAA-WKULSOCRSA-N |
| XLogP | 2.52 |
| TPSA | 182.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.56 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|