C20H26N2O9 — CID 145069158
(2S)-2-[[(1S)-1-carboxy-5-[(4-methylbenzoyl)amino]pentyl]carbamoyloxy]pentanedioic acid (PubChem CID 145069158) has the molecular formula C20H26N2O9 and a molecular weight of 438.43 g/mol. Its IUPAC name is (2S)-2-[[(1S)-1-carboxy-5-[(4-methylbenzoyl)amino]pentyl]carbamoyloxy]pentanedioic acid.
| Compound Name | (2S)-2-[[(1S)-1-carboxy-5-[(4-methylbenzoyl)amino]pentyl]carbamoyloxy]pentanedioic acid |
|---|---|
| PubChem CID | 145069158 |
| Molecular Formula | C20H26N2O9 |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | (2S)-2-[[(1S)-1-carboxy-5-[(4-methylbenzoyl)amino]pentyl]carbamoyloxy]pentanedioic acid |
| SMILES | Cc1ccc(C(=O)NCCCC[C@H](NC(=O)O[C@@H](CCC(=O)O)C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C20H26N2O9/c1-12-5-7-13(8-6-12)17(25)21-11-3-2-4-14(18(26)27)22-20(30)31-15(19(28)29)9-10-16(23)24/h5-8,14-15H,2-4,9-11H2,1H3,(H,21,25)(H,22,30)(H,23,24)(H,26,27)(H,28,29)/t14-,15-/m0/s1 |
| InChIKey | SDHLBTUZWVZKEI-GJZGRUSLSA-N |
| XLogP | 1.39 |
| TPSA | 179.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|