C23H26N2O9 — CID 154619061
(2S)-2-[[(1S)-1-formyloxy-5-(naphthalene-2-carbonylamino)pentoxy]carbonylamino]pentanedioic acid (PubChem CID 154619061) has the molecular formula C23H26N2O9 and a molecular weight of 474.47 g/mol. Its IUPAC name is (2S)-2-[[(1S)-1-formyloxy-5-(naphthalene-2-carbonylamino)pentoxy]carbonylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(1S)-1-formyloxy-5-(naphthalene-2-carbonylamino)pentoxy]carbonylamino]pentanedioic acid |
|---|---|
| PubChem CID | 154619061 |
| Molecular Formula | C23H26N2O9 |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | (2S)-2-[[(1S)-1-formyloxy-5-(naphthalene-2-carbonylamino)pentoxy]carbonylamino]pentanedioic acid |
| SMILES | O=COC(CCCCNC(=O)c1ccc2ccccc2c1)OC(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C23H26N2O9/c26-14-33-20(34-23(32)25-18(22(30)31)10-11-19(27)28)7-3-4-12-24-21(29)17-9-8-15-5-1-2-6-16(15)13-17/h1-2,5-6,8-9,13-14,18,20H,3-4,7,10-12H2,(H,24,29)(H,25,32)(H,27,28)(H,30,31)/t18-,20?/m0/s1 |
| InChIKey | OATITGJSTMFVFE-LROBGIAVSA-N |
| XLogP | 2.28 |
| TPSA | 168.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|