C17H19FN2O9 — CID 154619041
(2S)-2-[[(1S)-3-[(4-fluorobenzoyl)amino]-1-formyloxypropoxy]carbonylamino]pentanedioic acid (PubChem CID 154619041) has the molecular formula C17H19FN2O9 and a molecular weight of 414.34 g/mol. Its IUPAC name is (2S)-2-[[(1S)-3-[(4-fluorobenzoyl)amino]-1-formyloxypropoxy]carbonylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(1S)-3-[(4-fluorobenzoyl)amino]-1-formyloxypropoxy]carbonylamino]pentanedioic acid |
|---|---|
| PubChem CID | 154619041 |
| Molecular Formula | C17H19FN2O9 |
| Molecular Weight | 414.34 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | (2S)-2-[[(1S)-3-[(4-fluorobenzoyl)amino]-1-formyloxypropoxy]carbonylamino]pentanedioic acid |
| SMILES | O=CO[C@H](CCNC(=O)c1ccc(F)cc1)OC(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H19FN2O9/c18-11-3-1-10(2-4-11)15(24)19-8-7-14(28-9-21)29-17(27)20-12(16(25)26)5-6-13(22)23/h1-4,9,12,14H,5-8H2,(H,19,24)(H,20,27)(H,22,23)(H,25,26)/t12-,14-/m0/s1 |
| InChIKey | NGXIHAPGWFCICW-JSGCOSHPSA-N |
| XLogP | 0.49 |
| TPSA | 168.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.34 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|