C25H30FN5O6 — CID 88933533
2-[5-[[4-[(2Z)-2-[(4-fluorophenyl)methylidene]hydrazinyl]benzoyl]amino]pentylcarbamoylamino]pentanedioic acid (PubChem CID 88933533) has the molecular formula C25H30FN5O6 and a molecular weight of 514.54 g/mol. Its IUPAC name is 2-[5-[[4-[(2Z)-2-[(4-fluorophenyl)methylidene]hydrazinyl]benzoyl]amino]pentylcarbamoylamino]pentanedioic acid.
| Compound Name | 2-[5-[[4-[(2Z)-2-[(4-fluorophenyl)methylidene]hydrazinyl]benzoyl]amino]pentylcarbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 88933533 |
| Molecular Formula | C25H30FN5O6 |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | 2-[5-[[4-[(2Z)-2-[(4-fluorophenyl)methylidene]hydrazinyl]benzoyl]amino]pentylcarbamoylamino]pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)NCCCCCNC(=O)c1ccc(N/N=C\c2ccc([18F])cc2)cc1)C(=O)O |
| InChI | InChI=1S/C25H30FN5O6/c26-19-8-4-17(5-9-19)16-29-31-20-10-6-18(7-11-20)23(34)27-14-2-1-3-15-28-25(37)30-21(24(35)36)12-13-22(32)33/h4-11,16,21,31H,1-3,12-15H2,(H,27,34)(H,32,33)(H,35,36)(H2,28,30,37)/b29-16-/i26-1 |
| InChIKey | PAPBILOSWWIONN-MVWGJKEFSA-N |
| XLogP | 2.79 |
| TPSA | 169.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|