C20H29IN6O6 — CID 154599883
(2S)-2-[5-[[4-[(diaminomethylideneamino)methyl]-3-(131I)iodobenzoyl]amino]pentylcarbamoylamino]pentanedioic acid (PubChem CID 154599883) has the molecular formula C20H29IN6O6 and a molecular weight of 580.39 g/mol. Its IUPAC name is (2S)-2-[5-[[4-[(diaminomethylideneamino)methyl]-3-(131I)iodobenzoyl]amino]pentylcarbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[5-[[4-[(diaminomethylideneamino)methyl]-3-(131I)iodobenzoyl]amino]pentylcarbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 154599883 |
| Molecular Formula | C20H29IN6O6 |
| Molecular Weight | 580.39 g/mol |
| Exact Mass | 580.12 |
| IUPAC Name | (2S)-2-[5-[[4-[(diaminomethylideneamino)methyl]-3-(131I)iodobenzoyl]amino]pentylcarbamoylamino]pentanedioic acid |
| SMILES | NC(N)=NCc1ccc(C(=O)NCCCCCNC(=O)N[C@@H](CCC(=O)O)C(=O)O)cc1[131I] |
| InChI | InChI=1S/C20H29IN6O6/c21-14-10-12(4-5-13(14)11-26-19(22)23)17(30)24-8-2-1-3-9-25-20(33)27-15(18(31)32)6-7-16(28)29/h4-5,10,15H,1-3,6-9,11H2,(H,24,30)(H,28,29)(H,31,32)(H4,22,23,26)(H2,25,27,33)/t15-/m0/s1/i21+4 |
| InChIKey | IKADKLARONQWOW-MJZRRFTDSA-N |
| XLogP | 0.58 |
| TPSA | 209.23 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.39 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|