C18H25IN4O6 — CID 71143080
(2S)-2-[5-[(4-iodophenyl)carbamoylamino]pentylcarbamoylamino]pentanedioic acid (PubChem CID 71143080) has the molecular formula C18H25IN4O6 and a molecular weight of 524.33 g/mol. Its IUPAC name is (2S)-2-[5-[(4-iodophenyl)carbamoylamino]pentylcarbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[5-[(4-iodophenyl)carbamoylamino]pentylcarbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 71143080 |
| Molecular Formula | C18H25IN4O6 |
| Molecular Weight | 524.33 g/mol |
| Exact Mass | 524.08 |
| IUPAC Name | (2S)-2-[5-[(4-iodophenyl)carbamoylamino]pentylcarbamoylamino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)NCCCCCNC(=O)Nc1ccc([131I])cc1)C(=O)O |
| InChI | InChI=1S/C18H25IN4O6/c19-12-4-6-13(7-5-12)22-17(28)20-10-2-1-3-11-21-18(29)23-14(16(26)27)8-9-15(24)25/h4-7,14H,1-3,8-11H2,(H,24,25)(H,26,27)(H2,20,22,28)(H2,21,23,29)/t14-/m0/s1/i19+4 |
| InChIKey | VDFITNRJINCDNX-ULLVVOAZSA-N |
| XLogP | 2.20 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|