C16H22N4O6 — CID 143672056
2-(carboxymethylcarbamoylamino)-6-(phenylcarbamoylamino)hexanoic acid (PubChem CID 143672056) has the molecular formula C16H22N4O6 and a molecular weight of 366.37 g/mol. Its IUPAC name is 2-(carboxymethylcarbamoylamino)-6-(phenylcarbamoylamino)hexanoic acid.
| Compound Name | 2-(carboxymethylcarbamoylamino)-6-(phenylcarbamoylamino)hexanoic acid |
|---|---|
| PubChem CID | 143672056 |
| Molecular Formula | C16H22N4O6 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 2-(carboxymethylcarbamoylamino)-6-(phenylcarbamoylamino)hexanoic acid |
| SMILES | O=C(O)CNC(=O)NC(CCCCNC(=O)Nc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H22N4O6/c21-13(22)10-18-16(26)20-12(14(23)24)8-4-5-9-17-15(25)19-11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10H2,(H,21,22)(H,23,24)(H2,17,19,25)(H2,18,20,26) |
| InChIKey | XSMFOVFVYUYUOW-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|