C18H26N4O6 — CID 143672011
3-(carboxymethylcarbamoylamino)-7-[(4-methylphenyl)carbamoylamino]heptanoic acid (PubChem CID 143672011) has the molecular formula C18H26N4O6 and a molecular weight of 394.43 g/mol. Its IUPAC name is 3-(carboxymethylcarbamoylamino)-7-[(4-methylphenyl)carbamoylamino]heptanoic acid.
| Compound Name | 3-(carboxymethylcarbamoylamino)-7-[(4-methylphenyl)carbamoylamino]heptanoic acid |
|---|---|
| PubChem CID | 143672011 |
| Molecular Formula | C18H26N4O6 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 3-(carboxymethylcarbamoylamino)-7-[(4-methylphenyl)carbamoylamino]heptanoic acid |
| SMILES | Cc1ccc(NC(=O)NCCCCC(CC(=O)O)NC(=O)NCC(=O)O)cc1 |
| InChI | InChI=1S/C18H26N4O6/c1-12-5-7-13(8-6-12)21-17(27)19-9-3-2-4-14(10-15(23)24)22-18(28)20-11-16(25)26/h5-8,14H,2-4,9-11H2,1H3,(H,23,24)(H,25,26)(H2,19,21,27)(H2,20,22,28) |
| InChIKey | SKNLMFXKUBKOEP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|