C17H25N3O3 — CID 70068338
N-methyl-8-[(4-methylphenyl)carbamoylamino]-2-oxooctanamide (PubChem CID 70068338) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is N-methyl-8-[(4-methylphenyl)carbamoylamino]-2-oxooctanamide.
| Compound Name | N-methyl-8-[(4-methylphenyl)carbamoylamino]-2-oxooctanamide |
|---|---|
| PubChem CID | 70068338 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | N-methyl-8-[(4-methylphenyl)carbamoylamino]-2-oxooctanamide |
| SMILES | CNC(=O)C(=O)CCCCCCNC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C17H25N3O3/c1-13-8-10-14(11-9-13)20-17(23)19-12-6-4-3-5-7-15(21)16(22)18-2/h8-11H,3-7,12H2,1-2H3,(H,18,22)(H2,19,20,23) |
| InChIKey | QXFMGNPCAAAXOD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|