C16H22FN3O5 — CID 135163234
(2S)-2-(carboxymethylcarbamoylamino)-6-[(4-fluorophenyl)methylamino]hexanoic acid (PubChem CID 135163234) has the molecular formula C16H22FN3O5 and a molecular weight of 355.37 g/mol. Its IUPAC name is (2S)-2-(carboxymethylcarbamoylamino)-6-[(4-fluorophenyl)methylamino]hexanoic acid.
| Compound Name | (2S)-2-(carboxymethylcarbamoylamino)-6-[(4-fluorophenyl)methylamino]hexanoic acid |
|---|---|
| PubChem CID | 135163234 |
| Molecular Formula | C16H22FN3O5 |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | (2S)-2-(carboxymethylcarbamoylamino)-6-[(4-fluorophenyl)methylamino]hexanoic acid |
| SMILES | O=C(O)CNC(=O)N[C@@H](CCCCNCc1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C16H22FN3O5/c17-12-6-4-11(5-7-12)9-18-8-2-1-3-13(15(23)24)20-16(25)19-10-14(21)22/h4-7,13,18H,1-3,8-10H2,(H,21,22)(H,23,24)(H2,19,20,25)/t13-/m0/s1 |
| InChIKey | APNQLIXRPHXMDE-ZDUSSCGKSA-N |
| XLogP | 0.92 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|