C20H28IN3O7 — CID 24953793
(2S)-2-[[(2S)-1-carboxy-6-[(4-iodophenyl)methylamino]hexan-2-yl]carbamoylamino]pentanedioic acid (PubChem CID 24953793) has the molecular formula C20H28IN3O7 and a molecular weight of 549.36 g/mol. Its IUPAC name is (2S)-2-[[(2S)-1-carboxy-6-[(4-iodophenyl)methylamino]hexan-2-yl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(2S)-1-carboxy-6-[(4-iodophenyl)methylamino]hexan-2-yl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 24953793 |
| Molecular Formula | C20H28IN3O7 |
| Molecular Weight | 549.36 g/mol |
| Exact Mass | 549.10 |
| IUPAC Name | (2S)-2-[[(2S)-1-carboxy-6-[(4-iodophenyl)methylamino]hexan-2-yl]carbamoylamino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)N[C@@H](CCCCNCc1ccc(I)cc1)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H28IN3O7/c21-14-6-4-13(5-7-14)12-22-10-2-1-3-15(11-18(27)28)23-20(31)24-16(19(29)30)8-9-17(25)26/h4-7,15-16,22H,1-3,8-12H2,(H,25,26)(H,27,28)(H,29,30)(H2,23,24,31)/t15-,16-/m0/s1 |
| InChIKey | CPPOFHCZVCGJLU-HOTGVXAUSA-N |
| XLogP | 2.01 |
| TPSA | 165.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|