C16H23N5O6 — CID 130432437
(2S)-2-[5-(pyridazine-3-carbonylamino)pentylcarbamoylamino]pentanedioic acid (PubChem CID 130432437) has the molecular formula C16H23N5O6 and a molecular weight of 381.39 g/mol. Its IUPAC name is (2S)-2-[5-(pyridazine-3-carbonylamino)pentylcarbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[5-(pyridazine-3-carbonylamino)pentylcarbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 130432437 |
| Molecular Formula | C16H23N5O6 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | (2S)-2-[5-(pyridazine-3-carbonylamino)pentylcarbamoylamino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)NCCCCCNC(=O)c1cccnn1)C(=O)O |
| InChI | InChI=1S/C16H23N5O6/c22-13(23)7-6-12(15(25)26)20-16(27)18-9-3-1-2-8-17-14(24)11-5-4-10-19-21-11/h4-5,10,12H,1-3,6-9H2,(H,17,24)(H,22,23)(H,25,26)(H2,18,20,27)/t12-/m0/s1 |
| InChIKey | XRADSBHAHUOTEM-LBPRGKRZSA-N |
| XLogP | -0.01 |
| TPSA | 170.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|