C14H18FN3O5S — CID 121296871
2-[2-[(2-(18F)fluoro-3-pyridinyl)methylsulfanyl]ethylcarbamoylamino]pentanedioic acid (PubChem CID 121296871) has the molecular formula C14H18FN3O5S and a molecular weight of 358.38 g/mol. Its IUPAC name is 2-[2-[(2-(18F)fluoro-3-pyridinyl)methylsulfanyl]ethylcarbamoylamino]pentanedioic acid.
| Compound Name | 2-[2-[(2-(18F)fluoro-3-pyridinyl)methylsulfanyl]ethylcarbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 121296871 |
| Molecular Formula | C14H18FN3O5S |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 2-[2-[(2-(18F)fluoro-3-pyridinyl)methylsulfanyl]ethylcarbamoylamino]pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)NCCSCc1cccnc1[18F])C(=O)O |
| InChI | InChI=1S/C14H18FN3O5S/c15-12-9(2-1-5-16-12)8-24-7-6-17-14(23)18-10(13(21)22)3-4-11(19)20/h1-2,5,10H,3-4,6-8H2,(H,19,20)(H,21,22)(H2,17,18,23)/i15-1 |
| InChIKey | FUUVUTYTLYTIRZ-HUYCHCPVSA-N |
| XLogP | 1.07 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|