C17H22FN3O7S — CID 75060570
2-[[1-carboxy-4-[(2-fluoro-4-pyridinyl)methylsulfanyl]butyl]carbamoylamino]pentanedioic acid (PubChem CID 75060570) has the molecular formula C17H22FN3O7S and a molecular weight of 431.44 g/mol. Its IUPAC name is 2-[[1-carboxy-4-[(2-fluoro-4-pyridinyl)methylsulfanyl]butyl]carbamoylamino]pentanedioic acid.
| Compound Name | 2-[[1-carboxy-4-[(2-fluoro-4-pyridinyl)methylsulfanyl]butyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 75060570 |
| Molecular Formula | C17H22FN3O7S |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 2-[[1-carboxy-4-[(2-fluoro-4-pyridinyl)methylsulfanyl]butyl]carbamoylamino]pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)NC(CCCSCc1ccnc(F)c1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C17H22FN3O7S/c18-13-8-10(5-6-19-13)9-29-7-1-2-11(15(24)25)20-17(28)21-12(16(26)27)3-4-14(22)23/h5-6,8,11-12H,1-4,7,9H2,(H,22,23)(H,24,25)(H,26,27)(H2,20,21,28) |
| InChIKey | BVNGXCKLJVHUTD-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 165.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|