C16H22FN5O6 — CID 130432468
(2S)-2-[5-[(5-(18F)fluoropyrazine-2-carbonyl)amino]pentylcarbamoylamino]pentanedioic acid (PubChem CID 130432468) has the molecular formula C16H22FN5O6 and a molecular weight of 398.38 g/mol. Its IUPAC name is (2S)-2-[5-[(5-(18F)fluoropyrazine-2-carbonyl)amino]pentylcarbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[5-[(5-(18F)fluoropyrazine-2-carbonyl)amino]pentylcarbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 130432468 |
| Molecular Formula | C16H22FN5O6 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | (2S)-2-[5-[(5-(18F)fluoropyrazine-2-carbonyl)amino]pentylcarbamoylamino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)NCCCCCNC(=O)c1cnc([18F])cn1)C(=O)O |
| InChI | InChI=1S/C16H22FN5O6/c17-12-9-20-11(8-21-12)14(25)18-6-2-1-3-7-19-16(28)22-10(15(26)27)4-5-13(23)24/h8-10H,1-7H2,(H,18,25)(H,23,24)(H,26,27)(H2,19,22,28)/t10-/m0/s1/i17-1 |
| InChIKey | ARNFDSGTQUWWAT-QFJKFNFFSA-N |
| XLogP | 0.13 |
| TPSA | 170.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|