C38H66N6O8Sn — CID 154599866
(2R)-2-[5-[[4-oxo-4-[5-[(5-tributylstannylpyridine-3-carbonyl)amino]pentylamino]butanoyl]amino]pentylcarbamoylamino]pentanedioic acid (PubChem CID 154599866) has the molecular formula C38H66N6O8Sn and a molecular weight of 853.69 g/mol. Its IUPAC name is (2R)-2-[5-[[4-oxo-4-[5-[(5-tributylstannylpyridine-3-carbonyl)amino]pentylamino]butanoyl]amino]pentylcarbamoylamino]pentanedioic acid.
| Compound Name | (2R)-2-[5-[[4-oxo-4-[5-[(5-tributylstannylpyridine-3-carbonyl)amino]pentylamino]butanoyl]amino]pentylcarbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 154599866 |
| Molecular Formula | C38H66N6O8Sn |
| Molecular Weight | 853.69 g/mol |
| Exact Mass | 854.40 |
| IUPAC Name | (2R)-2-[5-[[4-oxo-4-[5-[(5-tributylstannylpyridine-3-carbonyl)amino]pentylamino]butanoyl]amino]pentylcarbamoylamino]pentanedioic acid |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cncc(C(=O)NCCCCCNC(=O)CCC(=O)NCCCCCNC(=O)N[C@H](CCC(=O)O)C(=O)O)c1 |
| InChI | InChI=1S/C26H39N6O8.3C4H9.Sn/c33-21(28-14-3-1-5-16-30-24(37)19-8-7-13-27-18-19)10-11-22(34)29-15-4-2-6-17-31-26(40)32-20(25(38)39)9-12-23(35)36;3*1-3-4-2;/h8,13,18,20H,1-6,9-12,14-17H2,(H,28,33)(H,29,34)(H,30,37)(H,35,36)(H,38,39)(H2,31,32,40);3*1,3-4H2,2H3;/t20-;;;;/m1..../s1 |
| InChIKey | KWNVFHKXMXYZSJ-YFDXKITBSA-N |
| XLogP | 4.84 |
| TPSA | 215.92 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.69 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|