C35H54N8O12 — CID 145300751
(2S)-2-[[1-carboxy-5-[[8-[[1-carboxy-5-[[4-[(diaminomethylideneamino)methyl]benzoyl]amino]pentyl]amino]-8-oxooctanoyl]amino]pentyl]carbamoylamino]pentanedioic acid (PubChem CID 145300751) has the molecular formula C35H54N8O12 and a molecular weight of 778.86 g/mol. Its IUPAC name is (2S)-2-[[1-carboxy-5-[[8-[[1-carboxy-5-[[4-[(diaminomethylideneamino)methyl]benzoyl]amino]pentyl]amino]-8-oxooctanoyl]amino]pentyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[1-carboxy-5-[[8-[[1-carboxy-5-[[4-[(diaminomethylideneamino)methyl]benzoyl]amino]pentyl]amino]-8-oxooctanoyl]amino]pentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 145300751 |
| Molecular Formula | C35H54N8O12 |
| Molecular Weight | 778.86 g/mol |
| Exact Mass | 778.39 |
| IUPAC Name | (2S)-2-[[1-carboxy-5-[[8-[[1-carboxy-5-[[4-[(diaminomethylideneamino)methyl]benzoyl]amino]pentyl]amino]-8-oxooctanoyl]amino]pentyl]carbamoylamino]pentanedioic acid |
| SMILES | NC(N)=NCc1ccc(C(=O)NCCCCC(NC(=O)CCCCCCC(=O)NCCCCC(NC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C35H54N8O12/c36-34(37)40-21-22-13-15-23(16-14-22)30(48)39-20-8-6-9-24(31(49)50)41-28(45)12-4-2-1-3-11-27(44)38-19-7-5-10-25(32(51)52)42-35(55)43-26(33(53)54)17-18-29(46)47/h13-16,24-26H,1-12,17-21H2,(H,38,44)(H,39,48)(H,41,45)(H,46,47)(H,49,50)(H,51,52)(H,53,54)(H4,36,37,40)(H2,42,43,55)/t24?,25?,26-/m0/s1 |
| InChIKey | DEVBJIXUEIHMPX-WNMGUVTHSA-N |
| XLogP | 0.63 |
| TPSA | 342.03 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.86 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|