C21H29N3O7 — CID 163560118
(4S)-4-[[(1S)-1-carboxy-5-[(4-methylbenzoyl)amino]pentyl]carbamoylamino]-5-oxohexanoic acid (PubChem CID 163560118) has the molecular formula C21H29N3O7 and a molecular weight of 435.48 g/mol. Its IUPAC name is (4S)-4-[[(1S)-1-carboxy-5-[(4-methylbenzoyl)amino]pentyl]carbamoylamino]-5-oxohexanoic acid.
| Compound Name | (4S)-4-[[(1S)-1-carboxy-5-[(4-methylbenzoyl)amino]pentyl]carbamoylamino]-5-oxohexanoic acid |
|---|---|
| PubChem CID | 163560118 |
| Molecular Formula | C21H29N3O7 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | (4S)-4-[[(1S)-1-carboxy-5-[(4-methylbenzoyl)amino]pentyl]carbamoylamino]-5-oxohexanoic acid |
| SMILES | CC(=O)[C@H](CCC(=O)O)NC(=O)N[C@@H](CCCCNC(=O)c1ccc(C)cc1)C(=O)O |
| InChI | InChI=1S/C21H29N3O7/c1-13-6-8-15(9-7-13)19(28)22-12-4-3-5-17(20(29)30)24-21(31)23-16(14(2)25)10-11-18(26)27/h6-9,16-17H,3-5,10-12H2,1-2H3,(H,22,28)(H,26,27)(H,29,30)(H2,23,24,31)/t16-,17-/m0/s1 |
| InChIKey | FQNHMMQDUWOLNU-IRXDYDNUSA-N |
| XLogP | 1.47 |
| TPSA | 161.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|