C24H35N3O5 — CID 90951618
N-[5-(2,6-dioxoheptan-3-ylcarbamoylamino)-6-oxoheptyl]-3,4-dimethylbenzamide (PubChem CID 90951618) has the molecular formula C24H35N3O5 and a molecular weight of 445.56 g/mol. Its IUPAC name is N-[5-(2,6-dioxoheptan-3-ylcarbamoylamino)-6-oxoheptyl]-3,4-dimethylbenzamide.
| Compound Name | N-[5-(2,6-dioxoheptan-3-ylcarbamoylamino)-6-oxoheptyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 90951618 |
| Molecular Formula | C24H35N3O5 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | N-[5-(2,6-dioxoheptan-3-ylcarbamoylamino)-6-oxoheptyl]-3,4-dimethylbenzamide |
| SMILES | CC(=O)CCC(NC(=O)NC(CCCCNC(=O)c1ccc(C)c(C)c1)C(C)=O)C(C)=O |
| InChI | InChI=1S/C24H35N3O5/c1-15-9-11-20(14-16(15)2)23(31)25-13-7-6-8-21(18(4)29)26-24(32)27-22(19(5)30)12-10-17(3)28/h9,11,14,21-22H,6-8,10,12-13H2,1-5H3,(H,25,31)(H2,26,27,32) |
| InChIKey | UVEFSDVXMAAQKD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|