C23H39N3O3 — CID 123597435
1-[6-(benzylamino)hexan-2-yl]-3-(2,6-dioxoheptan-3-yl)urea;ethane (PubChem CID 123597435) has the molecular formula C23H39N3O3 and a molecular weight of 405.58 g/mol. Its IUPAC name is 1-[6-(benzylamino)hexan-2-yl]-3-(2,6-dioxoheptan-3-yl)urea;ethane.
| Compound Name | 1-[6-(benzylamino)hexan-2-yl]-3-(2,6-dioxoheptan-3-yl)urea;ethane |
|---|---|
| PubChem CID | 123597435 |
| Molecular Formula | C23H39N3O3 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.30 |
| IUPAC Name | 1-[6-(benzylamino)hexan-2-yl]-3-(2,6-dioxoheptan-3-yl)urea;ethane |
| SMILES | CC.CC(=O)CCC(NC(=O)NC(C)CCCCNCc1ccccc1)C(C)=O |
| InChI | InChI=1S/C21H33N3O3.C2H6/c1-16(9-7-8-14-22-15-19-10-5-4-6-11-19)23-21(27)24-20(18(3)26)13-12-17(2)25;1-2/h4-6,10-11,16,20,22H,7-9,12-15H2,1-3H3,(H2,23,24,27);1-2H3 |
| InChIKey | PEZSBBMMMNQHIB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|