C16H22N2O3 — CID 58617927
1-(2,6-dioxoheptan-3-yl)-3-(4-ethylphenyl)urea (PubChem CID 58617927) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 1-(2,6-dioxoheptan-3-yl)-3-(4-ethylphenyl)urea.
| Compound Name | 1-(2,6-dioxoheptan-3-yl)-3-(4-ethylphenyl)urea |
|---|---|
| PubChem CID | 58617927 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 1-(2,6-dioxoheptan-3-yl)-3-(4-ethylphenyl)urea |
| SMILES | CCc1ccc(NC(=O)NC(CCC(C)=O)C(C)=O)cc1 |
| InChI | InChI=1S/C16H22N2O3/c1-4-13-6-8-14(9-7-13)17-16(21)18-15(12(3)20)10-5-11(2)19/h6-9,15H,4-5,10H2,1-3H3,(H2,17,18,21) |
| InChIKey | HPYGXDJZJXKAQC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |