C16H21BrN2O3 — CID 159464677
1-(4-bromophenyl)-3-[(4S)-5,8-dioxononan-4-yl]urea (PubChem CID 159464677) has the molecular formula C16H21BrN2O3 and a molecular weight of 369.26 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[(4S)-5,8-dioxononan-4-yl]urea.
| Compound Name | 1-(4-bromophenyl)-3-[(4S)-5,8-dioxononan-4-yl]urea |
|---|---|
| PubChem CID | 159464677 |
| Molecular Formula | C16H21BrN2O3 |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 1-(4-bromophenyl)-3-[(4S)-5,8-dioxononan-4-yl]urea |
| SMILES | CCC[C@H](NC(=O)Nc1ccc(Br)cc1)C(=O)CCC(C)=O |
| InChI | InChI=1S/C16H21BrN2O3/c1-3-4-14(15(21)10-5-11(2)20)19-16(22)18-13-8-6-12(17)7-9-13/h6-9,14H,3-5,10H2,1-2H3,(H2,18,19,22)/t14-/m0/s1 |
| InChIKey | QGLFFCQROMRQNY-AWEZNQCLSA-N |
| XLogP | 3.68 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |