About 1-(4-bromophenyl)-3-[(4S)-5,8-dioxononan-4-yl]urea
1-(4-bromophenyl)-3-[(4S)-5,8-dioxononan-4-yl]urea (PubChem CID 159464677) has the molecular formula C16H21BrN2O3
and a molecular weight of 369.26 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[(4S)-5,8-dioxononan-4-yl]urea.
Molecular Properties
| Compound Name | 1-(4-bromophenyl)-3-[(4S)-5,8-dioxononan-4-yl]urea |
| PubChem CID | 159464677 |
| Molecular Formula | C16H21BrN2O3 |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 1-(4-bromophenyl)-3-[(4S)-5,8-dioxononan-4-yl]urea |
| SMILES | CCC[C@H](NC(=O)Nc1ccc(Br)cc1)C(=O)CCC(C)=O |
| InChI | InChI=1S/C16H21BrN2O3/c1-3-4-14(15(21)10-5-11(2)20)19-16(22)18-13-8-6-12(17)7-9-13/h6-9,14H,3-5,10H2,1-2H3,(H2,18,19,22)/t14-/m0/s1 |
| InChIKey | QGLFFCQROMRQNY-AWEZNQCLSA-N |
| XLogP | 3.68 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-bromophenyl)-3-[(4S)-5,8-dioxononan-4-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromophenyl)-3-[(4S)-5,8-dioxononan-4-yl]urea?
The IUPAC name of 1-(4-bromophenyl)-3-[(4S)-5,8-dioxononan-4-yl]urea (CID 159464677) is 1-(4-bromophenyl)-3-[(4S)-5,8-dioxononan-4-yl]urea.
What is the SMILES notation for 1-(4-bromophenyl)-3-[(4S)-5,8-dioxononan-4-yl]urea?
The canonical SMILES for 1-(4-bromophenyl)-3-[(4S)-5,8-dioxononan-4-yl]urea is CCC[C@H](NC(=O)Nc1ccc(Br)cc1)C(=O)CCC(C)=O.
What is the InChIKey of 1-(4-bromophenyl)-3-[(4S)-5,8-dioxononan-4-yl]urea?
The InChIKey is QGLFFCQROMRQNY-AWEZNQCLSA-N. The full InChI is InChI=1S/C16H21BrN2O3/c1-3-4-14(15(21)10-5-11(2)20)19-16(22)18-13-8-6-12(17)7-9-13/h6-9,14H,3-5,10H2,1-2H3,(H2,18,19,22)/t14-/m0/s1.
What are the key properties of 1-(4-bromophenyl)-3-[(4S)-5,8-dioxononan-4-yl]urea?
1-(4-bromophenyl)-3-[(4S)-5,8-dioxononan-4-yl]urea has a molecular weight of 369.26 g/mol, XLogP of 3.68, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromophenyl)-3-[(4S)-5,8-dioxononan-4-yl]urea is sourced from PubChem (CID 159464677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).